C20H40N2O3Si — CID 18657890
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1-ethylazetidin-3-yl)pyrrolidine-1-carboxylate (PubChem CID 18657890) has the molecular formula C20H40N2O3Si and a molecular weight of 384.64 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1-ethylazetidin-3-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1-ethylazetidin-3-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18657890 |
| Molecular Formula | C20H40N2O3Si |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1-ethylazetidin-3-yl)pyrrolidine-1-carboxylate |
| SMILES | CCN1CC([C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CN2C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H40N2O3Si/c1-10-21-12-15(13-21)17-11-16(25-26(8,9)20(5,6)7)14-22(17)18(23)24-19(2,3)4/h15-17H,10-14H2,1-9H3/t16-,17+/m1/s1 |
| InChIKey | AAIJSVJBDKRUKZ-SJORKVTESA-N |
| XLogP | 4.34 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|