C20H37NO5Si — CID 67749947
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-ethoxy-3-oxoprop-1-en-2-yl)pyrrolidine-1-carboxylate (PubChem CID 67749947) has the molecular formula C20H37NO5Si and a molecular weight of 399.60 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-ethoxy-3-oxoprop-1-en-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-ethoxy-3-oxoprop-1-en-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67749947 |
| Molecular Formula | C20H37NO5Si |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(3-ethoxy-3-oxoprop-1-en-2-yl)pyrrolidine-1-carboxylate |
| SMILES | C=C(C(=O)OCC)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37NO5Si/c1-11-24-17(22)14(2)16-12-15(26-27(9,10)20(6,7)8)13-21(16)18(23)25-19(3,4)5/h15-16H,2,11-13H2,1,3-10H3/t15-,16+/m1/s1 |
| InChIKey | YODSYDWQBPVHAN-CVEARBPZSA-N |
| XLogP | 4.51 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|