C18H34N2O4Si — CID 70276625
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyano-1-hydroxyethyl)pyrrolidine-1-carboxylate (PubChem CID 70276625) has the molecular formula C18H34N2O4Si and a molecular weight of 370.57 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyano-1-hydroxyethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyano-1-hydroxyethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70276625 |
| Molecular Formula | C18H34N2O4Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-cyano-1-hydroxyethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(O)CC#N |
| InChI | InChI=1S/C18H34N2O4Si/c1-17(2,3)23-16(22)20-12-13(11-14(20)15(21)9-10-19)24-25(7,8)18(4,5)6/h13-15,21H,9,11-12H2,1-8H3/t13-,14+,15?/m1/s1 |
| InChIKey | PWOFIUIXWIUECF-GNXJLENFSA-N |
| XLogP | 3.66 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|