C25H41N3O8Si — CID 10768778
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1-hydroxy-2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]pyrrolidine-1-carboxylate (PubChem CID 10768778) has the molecular formula C25H41N3O8Si and a molecular weight of 539.70 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1-hydroxy-2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1-hydroxy-2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10768778 |
| Molecular Formula | C25H41N3O8Si |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1-hydroxy-2-[(4-nitrophenyl)methoxycarbonylamino]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1[C@@H](O)CNC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H41N3O8Si/c1-24(2,3)35-23(31)27-15-19(36-37(7,8)25(4,5)6)13-20(27)21(29)14-26-22(30)34-16-17-9-11-18(12-10-17)28(32)33/h9-12,19-21,29H,13-16H2,1-8H3,(H,26,30)/t19-,20+,21+/m1/s1 |
| InChIKey | GEUVLZZTKZYSMF-HKBOAZHASA-N |
| XLogP | 4.58 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|