C18H27N3O6Si — CID 57102713
(4-nitrophenyl)methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-nitrosopyrrolidine-1-carboxylate (PubChem CID 57102713) has the molecular formula C18H27N3O6Si and a molecular weight of 409.52 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-nitrosopyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-nitrosopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57102713 |
| Molecular Formula | C18H27N3O6Si |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (4-nitrophenyl)methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-nitrosopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(N=O)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C18H27N3O6Si/c1-18(2,3)28(4,5)27-15-10-16(19-23)20(11-15)17(22)26-12-13-6-8-14(9-7-13)21(24)25/h6-9,15-16H,10-12H2,1-5H3/t15-,16?/m1/s1 |
| InChIKey | DOKDFLNUDAQMMY-AAFJCEBUSA-N |
| XLogP | 4.42 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|