C33H44N4O11Si — CID 57006913
(4-nitrophenyl)methyl (2S,4R)-2-[4-(acetyloxymethyl)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 57006913) has the molecular formula C33H44N4O11Si and a molecular weight of 700.82 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,4R)-2-[4-(acetyloxymethyl)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (2S,4R)-2-[4-(acetyloxymethyl)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57006913 |
| Molecular Formula | C33H44N4O11Si |
| Molecular Weight | 700.82 g/mol |
| Exact Mass | 700.28 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,4R)-2-[4-(acetyloxymethyl)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | CC(=O)OCC1CN(C(=O)OCc2ccc([N+](=O)[O-])cc2)CC1[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H44N4O11Si/c1-22(38)45-21-25-16-34(31(39)46-19-23-7-11-26(12-8-23)36(41)42)18-29(25)30-15-28(48-49(5,6)33(2,3)4)17-35(30)32(40)47-20-24-9-13-27(14-10-24)37(43)44/h7-14,25,28-30H,15-21H2,1-6H3/t25?,28-,29?,30+/m1/s1 |
| InChIKey | SZXPTZLTZURART-OSSBPYIESA-N |
| XLogP | 6.05 |
| TPSA | 180.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.82 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|