C16H22N2O7Si — CID 57244001
(2S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-trimethylsilyloxypyrrolidine-2-carboxylic acid (PubChem CID 57244001) has the molecular formula C16H22N2O7Si and a molecular weight of 382.45 g/mol. Its IUPAC name is (2S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-trimethylsilyloxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-trimethylsilyloxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 57244001 |
| Molecular Formula | C16H22N2O7Si |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (2S)-1-[(4-nitrophenyl)methoxycarbonyl]-4-trimethylsilyloxypyrrolidine-2-carboxylic acid |
| SMILES | C[Si](C)(C)OC1C[C@@H](C(=O)O)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C16H22N2O7Si/c1-26(2,3)25-13-8-14(15(19)20)17(9-13)16(21)24-10-11-4-6-12(7-5-11)18(22)23/h4-7,13-14H,8-10H2,1-3H3,(H,19,20)/t13?,14-/m0/s1 |
| InChIKey | IQJFDKLDPOZOQJ-KZUDCZAMSA-N |
| XLogP | 2.61 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|