C21H22N2O7S — CID 70275960
(2S,4S)-4-[(2-methoxyphenyl)methylsulfanyl]-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 70275960) has the molecular formula C21H22N2O7S and a molecular weight of 446.48 g/mol. Its IUPAC name is (2S,4S)-4-[(2-methoxyphenyl)methylsulfanyl]-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-[(2-methoxyphenyl)methylsulfanyl]-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70275960 |
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (2S,4S)-4-[(2-methoxyphenyl)methylsulfanyl]-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccccc1CS[C@H]1C[C@@H](C(=O)O)N(C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C21H22N2O7S/c1-29-19-5-3-2-4-15(19)13-31-17-10-18(20(24)25)22(11-17)21(26)30-12-14-6-8-16(9-7-14)23(27)28/h2-9,17-18H,10-13H2,1H3,(H,24,25)/t17-,18-/m0/s1 |
| InChIKey | TWRGSYXPEQKNQW-ROUUACIJSA-N |
| XLogP | 3.70 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|