C16H18N2O8S — CID 88605658
(2S)-4-ethoxycarbonylsulfanyl-1-[(2-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 88605658) has the molecular formula C16H18N2O8S and a molecular weight of 398.39 g/mol. Its IUPAC name is (2S)-4-ethoxycarbonylsulfanyl-1-[(2-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-ethoxycarbonylsulfanyl-1-[(2-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88605658 |
| Molecular Formula | C16H18N2O8S |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (2S)-4-ethoxycarbonylsulfanyl-1-[(2-nitrophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)SC1C[C@@H](C(=O)O)N(C(=O)OCc2ccccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H18N2O8S/c1-2-25-16(22)27-11-7-13(14(19)20)17(8-11)15(21)26-9-10-5-3-4-6-12(10)18(23)24/h3-6,11,13H,2,7-9H2,1H3,(H,19,20)/t11?,13-/m0/s1 |
| InChIKey | LLTWSKLKRQMMNW-YUZLPWPTSA-N |
| XLogP | 2.65 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|