C18H24N2O6 — CID 58143158
1-O-(2-methylbutan-2-yl) 2-O-[(2-nitrophenyl)methyl] pyrrolidine-1,2-dicarboxylate (PubChem CID 58143158) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-O-(2-methylbutan-2-yl) 2-O-[(2-nitrophenyl)methyl] pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-(2-methylbutan-2-yl) 2-O-[(2-nitrophenyl)methyl] pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58143158 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-O-(2-methylbutan-2-yl) 2-O-[(2-nitrophenyl)methyl] pyrrolidine-1,2-dicarboxylate |
| SMILES | CCC(C)(C)OC(=O)N1CCCC1C(=O)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N2O6/c1-4-18(2,3)26-17(22)19-11-7-10-15(19)16(21)25-12-13-8-5-6-9-14(13)20(23)24/h5-6,8-9,15H,4,7,10-12H2,1-3H3 |
| InChIKey | WQKJASBPVATBNJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|