C36H49ClN4O12 — CID 159553949
1-(chloromethyl)-2-nitrobenzene;1-O-(2-methylbutan-2-yl) 2-O-[(2-nitrophenyl)methyl] pyrrolidine-1,2-dicarboxylate;1-(2-methylbutan-2-yloxycarbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 159553949) has the molecular formula C36H49ClN4O12 and a molecular weight of 765.26 g/mol. Its IUPAC name is 1-(chloromethyl)-2-nitrobenzene;1-O-(2-methylbutan-2-yl) 2-O-[(2-nitrophenyl)methyl] pyrrolidine-1,2-dicarboxylate;1-(2-methylbutan-2-yloxycarbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(chloromethyl)-2-nitrobenzene;1-O-(2-methylbutan-2-yl) 2-O-[(2-nitrophenyl)methyl] pyrrolidine-1,2-dicarboxylate;1-(2-methylbutan-2-yloxycarbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 159553949 |
| Molecular Formula | C36H49ClN4O12 |
| Molecular Weight | 765.26 g/mol |
| Exact Mass | 764.30 |
| IUPAC Name | 1-(chloromethyl)-2-nitrobenzene;1-O-(2-methylbutan-2-yl) 2-O-[(2-nitrophenyl)methyl] pyrrolidine-1,2-dicarboxylate;1-(2-methylbutan-2-yloxycarbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCC(C)(C)OC(=O)N1CCCC1C(=O)O.CCC(C)(C)OC(=O)N1CCCC1C(=O)OCc1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1CCl |
| InChI | InChI=1S/C18H24N2O6.C11H19NO4.C7H6ClNO2/c1-4-18(2,3)26-17(22)19-11-7-10-15(19)16(21)25-12-13-8-5-6-9-14(13)20(23)24;1-4-11(2,3)16-10(15)12-7-5-6-8(12)9(13)14;8-5-6-3-1-2-4-7(6)9(10)11/h5-6,8-9,15H,4,7,10-12H2,1-3H3;8H,4-7H2,1-3H3,(H,13,14);1-4H,5H2 |
| InChIKey | MFTFWZVVAPHJMO-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 208.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.26 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|