C25H22N2O6S — CID 92524414
4-O-benzhydryl 3-O-[(2-nitrophenyl)methyl] (4R)-1,3-thiazolidine-3,4-dicarboxylate (PubChem CID 92524414) has the molecular formula C25H22N2O6S and a molecular weight of 478.53 g/mol. Its IUPAC name is 4-O-benzhydryl 3-O-[(2-nitrophenyl)methyl] (4R)-1,3-thiazolidine-3,4-dicarboxylate.
| Compound Name | 4-O-benzhydryl 3-O-[(2-nitrophenyl)methyl] (4R)-1,3-thiazolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 92524414 |
| Molecular Formula | C25H22N2O6S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4-O-benzhydryl 3-O-[(2-nitrophenyl)methyl] (4R)-1,3-thiazolidine-3,4-dicarboxylate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)[C@@H]1CSCN1C(=O)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H22N2O6S/c28-24(33-23(18-9-3-1-4-10-18)19-11-5-2-6-12-19)22-16-34-17-26(22)25(29)32-15-20-13-7-8-14-21(20)27(30)31/h1-14,22-23H,15-17H2/t22-/m0/s1 |
| InChIKey | SWCOOTSCHYEYKI-QFIPXVFZSA-N |
| XLogP | 4.94 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|