C17H22N2O3S — CID 14556727
benzyl (4R)-4-(piperidine-1-carbonyl)-1,3-thiazolidine-3-carboxylate (PubChem CID 14556727) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is benzyl (4R)-4-(piperidine-1-carbonyl)-1,3-thiazolidine-3-carboxylate.
| Compound Name | benzyl (4R)-4-(piperidine-1-carbonyl)-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 14556727 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | benzyl (4R)-4-(piperidine-1-carbonyl)-1,3-thiazolidine-3-carboxylate |
| SMILES | O=C([C@@H]1CSCN1C(=O)OCc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C17H22N2O3S/c20-16(18-9-5-2-6-10-18)15-12-23-13-19(15)17(21)22-11-14-7-3-1-4-8-14/h1,3-4,7-8,15H,2,5-6,9-13H2/t15-/m0/s1 |
| InChIKey | JWZITSKEPFLZJT-HNNXBMFYSA-N |
| XLogP | 2.71 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |