C12H20N2O2S — CID 86776938
1-[4-(azepane-1-carbonyl)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 86776938) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-[4-(azepane-1-carbonyl)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 1-[4-(azepane-1-carbonyl)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 86776938 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-[4-(azepane-1-carbonyl)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | CC(=O)N1CSCC1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C12H20N2O2S/c1-10(15)14-9-17-8-11(14)12(16)13-6-4-2-3-5-7-13/h11H,2-9H2,1H3 |
| InChIKey | QNBRVMKVXPOGAK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |