C20H26N2O3S — CID 97007779
1-(4-tert-butylphenyl)-2-[(4R)-4-(pyrrolidine-1-carbonyl)-1,3-thiazolidin-3-yl]ethane-1,2-dione (PubChem CID 97007779) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-[(4R)-4-(pyrrolidine-1-carbonyl)-1,3-thiazolidin-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-tert-butylphenyl)-2-[(4R)-4-(pyrrolidine-1-carbonyl)-1,3-thiazolidin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 97007779 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-[(4R)-4-(pyrrolidine-1-carbonyl)-1,3-thiazolidin-3-yl]ethane-1,2-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)C(=O)N2CSC[C@H]2C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H26N2O3S/c1-20(2,3)15-8-6-14(7-9-15)17(23)19(25)22-13-26-12-16(22)18(24)21-10-4-5-11-21/h6-9,16H,4-5,10-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | PUAHLUKFQBZBNE-INIZCTEOSA-N |
| XLogP | 2.69 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|