About benzyl piperidine-1-carboxylate
benzyl piperidine-1-carboxylate (PubChem CID 158057698) has the molecular formula C26H34N2O4
and a molecular weight of 438.57 g/mol. Its IUPAC name is benzyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl piperidine-1-carboxylate |
| PubChem CID | 158057698 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | benzyl piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCCC1.O=C(OCc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/2C13H17NO2/c2*15-13(14-9-5-2-6-10-14)16-11-12-7-3-1-4-8-12/h2*1,3-4,7-8H,2,5-6,9-11H2 |
| InChIKey | FKGNMXMECBKNTG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl piperidine-1-carboxylate?
The IUPAC name of benzyl piperidine-1-carboxylate (CID 158057698) is benzyl piperidine-1-carboxylate.
What is the SMILES notation for benzyl piperidine-1-carboxylate?
The canonical SMILES for benzyl piperidine-1-carboxylate is O=C(OCc1ccccc1)N1CCCCC1.O=C(OCc1ccccc1)N1CCCCC1.
What is the InChIKey of benzyl piperidine-1-carboxylate?
The InChIKey is FKGNMXMECBKNTG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H17NO2/c2*15-13(14-9-5-2-6-10-14)16-11-12-7-3-1-4-8-12/h2*1,3-4,7-8H,2,5-6,9-11H2.
What are the key properties of benzyl piperidine-1-carboxylate?
benzyl piperidine-1-carboxylate has a molecular weight of 438.57 g/mol, XLogP of 5.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl piperidine-1-carboxylate is sourced from PubChem (CID 158057698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).