About benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene
benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene (PubChem CID 143436152) has the molecular formula C19H21BrFNO2
and a molecular weight of 394.28 g/mol. Its IUPAC name is benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene.
Molecular Properties
| Compound Name | benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene |
| PubChem CID | 143436152 |
| Molecular Formula | C19H21BrFNO2 |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene |
| SMILES | Fc1ccccc1Br.O=C(OCc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C13H17NO2.C6H4BrF/c15-13(14-9-5-2-6-10-14)16-11-12-7-3-1-4-8-12;7-5-3-1-2-4-6(5)8/h1,3-4,7-8H,2,5-6,9-11H2;1-4H |
| InChIKey | REUDIAGEQRZHGF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene?
The IUPAC name of benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene (CID 143436152) is benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene.
What is the SMILES notation for benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene?
The canonical SMILES for benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene is Fc1ccccc1Br.O=C(OCc1ccccc1)N1CCCCC1.
What is the InChIKey of benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene?
The InChIKey is REUDIAGEQRZHGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2.C6H4BrF/c15-13(14-9-5-2-6-10-14)16-11-12-7-3-1-4-8-12;7-5-3-1-2-4-6(5)8/h1,3-4,7-8H,2,5-6,9-11H2;1-4H.
What are the key properties of benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene?
benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene has a molecular weight of 394.28 g/mol, XLogP of 5.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl piperidine-1-carboxylate;1-bromo-2-fluorobenzene is sourced from PubChem (CID 143436152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).