C15H20FNO3 — CID 122547417
benzyl 3-fluoro-4-hydroxyazocane-1-carboxylate (PubChem CID 122547417) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is benzyl 3-fluoro-4-hydroxyazocane-1-carboxylate.
| Compound Name | benzyl 3-fluoro-4-hydroxyazocane-1-carboxylate |
|---|---|
| PubChem CID | 122547417 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | benzyl 3-fluoro-4-hydroxyazocane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCCC(O)C(F)C1 |
| InChI | InChI=1S/C15H20FNO3/c16-13-10-17(9-5-4-8-14(13)18)15(19)20-11-12-6-2-1-3-7-12/h1-3,6-7,13-14,18H,4-5,8-11H2 |
| InChIKey | LFESIQATLNMJMM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |