C13H18ClFN2O2 — CID 129320025
benzyl (3R,4S)-4-amino-3-fluoropiperidine-1-carboxylate;hydrochloride (PubChem CID 129320025) has the molecular formula C13H18ClFN2O2 and a molecular weight of 288.75 g/mol. Its IUPAC name is benzyl (3R,4S)-4-amino-3-fluoropiperidine-1-carboxylate;hydrochloride.
| Compound Name | benzyl (3R,4S)-4-amino-3-fluoropiperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 129320025 |
| Molecular Formula | C13H18ClFN2O2 |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | benzyl (3R,4S)-4-amino-3-fluoropiperidine-1-carboxylate;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(C(=O)OCc2ccccc2)C[C@H]1F |
| InChI | InChI=1S/C13H17FN2O2.ClH/c14-11-8-16(7-6-12(11)15)13(17)18-9-10-4-2-1-3-5-10;/h1-5,11-12H,6-9,15H2;1H/t11-,12+;/m1./s1 |
| InChIKey | CVDZOJLGFLYIMX-LYCTWNKOSA-N |
| XLogP | 2.12 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |