C14H18FNO3 — CID 118230294
benzyl (3R,4R)-4-fluoro-3-hydroxyazepane-1-carboxylate (PubChem CID 118230294) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is benzyl (3R,4R)-4-fluoro-3-hydroxyazepane-1-carboxylate.
| Compound Name | benzyl (3R,4R)-4-fluoro-3-hydroxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 118230294 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | benzyl (3R,4R)-4-fluoro-3-hydroxyazepane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@@H](F)[C@H](O)C1 |
| InChI | InChI=1S/C14H18FNO3/c15-12-7-4-8-16(9-13(12)17)14(18)19-10-11-5-2-1-3-6-11/h1-3,5-6,12-13,17H,4,7-10H2/t12-,13-/m1/s1 |
| InChIKey | IZHHVYFYRXDSAO-CHWSQXEVSA-N |
| XLogP | 2.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |