C14H19FN2O2 — CID 124547561
benzyl (3R,4S)-3-fluoro-4-(methylamino)piperidine-1-carboxylate (PubChem CID 124547561) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is benzyl (3R,4S)-3-fluoro-4-(methylamino)piperidine-1-carboxylate.
| Compound Name | benzyl (3R,4S)-3-fluoro-4-(methylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 124547561 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | benzyl (3R,4S)-3-fluoro-4-(methylamino)piperidine-1-carboxylate |
| SMILES | CN[C@H]1CCN(C(=O)OCc2ccccc2)C[C@H]1F |
| InChI | InChI=1S/C14H19FN2O2/c1-16-13-7-8-17(9-12(13)15)14(18)19-10-11-5-3-2-4-6-11/h2-6,12-13,16H,7-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | ABMWQTWKPOPMIO-OLZOCXBDSA-N |
| XLogP | 1.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |