C20H24N2O2 — CID 14987150
benzyl (3R,4R)-4-anilino-3-methylpiperidine-1-carboxylate (PubChem CID 14987150) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is benzyl (3R,4R)-4-anilino-3-methylpiperidine-1-carboxylate.
| Compound Name | benzyl (3R,4R)-4-anilino-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 14987150 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | benzyl (3R,4R)-4-anilino-3-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OCc2ccccc2)CC[C@H]1Nc1ccccc1 |
| InChI | InChI=1S/C20H24N2O2/c1-16-14-22(20(23)24-15-17-8-4-2-5-9-17)13-12-19(16)21-18-10-6-3-7-11-18/h2-11,16,19,21H,12-15H2,1H3/t16-,19-/m1/s1 |
| InChIKey | YKLKVPCPWMQYDC-VQIMIIECSA-N |
| XLogP | 4.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |