About benzyl 3-methylpyrrolidine-1-carboxylate;ethane
benzyl 3-methylpyrrolidine-1-carboxylate;ethane (PubChem CID 164877739) has the molecular formula C19H35NO2
and a molecular weight of 309.49 g/mol. Its IUPAC name is benzyl 3-methylpyrrolidine-1-carboxylate;ethane.
Molecular Properties
| Compound Name | benzyl 3-methylpyrrolidine-1-carboxylate;ethane |
| PubChem CID | 164877739 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | benzyl 3-methylpyrrolidine-1-carboxylate;ethane |
| SMILES | CC.CC.CC.CC1CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C13H17NO2.3C2H6/c1-11-7-8-14(9-11)13(15)16-10-12-5-3-2-4-6-12;3*1-2/h2-6,11H,7-10H2,1H3;3*1-2H3 |
| InChIKey | AFXZPXJDUPGDBC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl 3-methylpyrrolidine-1-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-methylpyrrolidine-1-carboxylate;ethane?
The IUPAC name of benzyl 3-methylpyrrolidine-1-carboxylate;ethane (CID 164877739) is benzyl 3-methylpyrrolidine-1-carboxylate;ethane.
What is the SMILES notation for benzyl 3-methylpyrrolidine-1-carboxylate;ethane?
The canonical SMILES for benzyl 3-methylpyrrolidine-1-carboxylate;ethane is CC.CC.CC.CC1CCN(C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl 3-methylpyrrolidine-1-carboxylate;ethane?
The InChIKey is AFXZPXJDUPGDBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2.3C2H6/c1-11-7-8-14(9-11)13(15)16-10-12-5-3-2-4-6-12;3*1-2/h2-6,11H,7-10H2,1H3;3*1-2H3.
What are the key properties of benzyl 3-methylpyrrolidine-1-carboxylate;ethane?
benzyl 3-methylpyrrolidine-1-carboxylate;ethane has a molecular weight of 309.49 g/mol, XLogP of 5.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-methylpyrrolidine-1-carboxylate;ethane is sourced from PubChem (CID 164877739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).