C14H19NO4 — CID 90178387
benzyl (3R,4R)-4-hydroxy-3-methoxypiperidine-1-carboxylate (PubChem CID 90178387) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is benzyl (3R,4R)-4-hydroxy-3-methoxypiperidine-1-carboxylate.
| Compound Name | benzyl (3R,4R)-4-hydroxy-3-methoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 90178387 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | benzyl (3R,4R)-4-hydroxy-3-methoxypiperidine-1-carboxylate |
| SMILES | CO[C@@H]1CN(C(=O)OCc2ccccc2)CC[C@H]1O |
| InChI | InChI=1S/C14H19NO4/c1-18-13-9-15(8-7-12(13)16)14(17)19-10-11-5-3-2-4-6-11/h2-6,12-13,16H,7-10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | YUKRJFHZKRYZMY-CHWSQXEVSA-N |
| XLogP | 1.40 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |