C25H30N2O7 — CID 160894007
benzyl (3S)-3-hydroxy-4-methoxypyrrolidine-1-carboxylate;benzyl 6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 160894007) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is benzyl (3S)-3-hydroxy-4-methoxypyrrolidine-1-carboxylate;benzyl 6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | benzyl (3S)-3-hydroxy-4-methoxypyrrolidine-1-carboxylate;benzyl 6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 160894007 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | benzyl (3S)-3-hydroxy-4-methoxypyrrolidine-1-carboxylate;benzyl 6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | COC1CN(C(=O)OCc2ccccc2)C[C@@H]1O.O=C(OCc1ccccc1)N1CC2OC2C1 |
| InChI | InChI=1S/C13H17NO4.C12H13NO3/c1-17-12-8-14(7-11(12)15)13(16)18-9-10-5-3-2-4-6-10;14-12(13-6-10-11(7-13)16-10)15-8-9-4-2-1-3-5-9/h2-6,11-12,15H,7-9H2,1H3;1-5,10-11H,6-8H2/t11-,12?;/m0./s1 |
| InChIKey | SOQCLMSVWPTEJP-YLIVSKOQSA-N |
| XLogP | 2.42 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|