benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate

C14H19NO4 — CID 142802088

IUPACbenzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate
SMILESCOC1CN(C(=O)OCc2ccccc2)C[C@@H]1OC
InChIInChI=1S/C14H19NO4/c1-17-12-8-15(9-13(12)18-2)14(16)19-10-11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3/t12-,13?/m0/s1
InChIKeyPOZQTSVBFIYXQI-UEWDXFNNSA-N
MW265.31 g/mol
LogP1.67
Rot. Bonds4

About benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate

benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate (PubChem CID 142802088) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate
PubChem CID142802088
Molecular FormulaC14H19NO4
Molecular Weight265.31 g/mol
Exact Mass265.13
IUPAC Namebenzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate
SMILESCOC1CN(C(=O)OCc2ccccc2)C[C@@H]1OC
InChIInChI=1S/C14H19NO4/c1-17-12-8-15(9-13(12)18-2)14(16)19-10-11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3/t12-,13?/m0/s1
InChIKeyPOZQTSVBFIYXQI-UEWDXFNNSA-N
XLogP1.67
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 51.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate?
The IUPAC name of benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate (CID 142802088) is benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate?
The canonical SMILES for benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate is COC1CN(C(=O)OCc2ccccc2)C[C@@H]1OC.
What is the InChIKey of benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate?
The InChIKey is POZQTSVBFIYXQI-UEWDXFNNSA-N. The full InChI is InChI=1S/C14H19NO4/c1-17-12-8-15(9-13(12)18-2)14(16)19-10-11-6-4-3-5-7-11/h3-7,12-13H,8-10H2,1-2H3/t12-,13?/m0/s1.
What are the key properties of benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate?
benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate has a molecular weight of 265.31 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3S)-3,4-dimethoxypyrrolidine-1-carboxylate is sourced from PubChem (CID 142802088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).