C14H19NO5 — CID 42638861
benzyl (3S,4R,5R)-3,4-dihydroxy-5-methoxypiperidine-1-carboxylate (PubChem CID 42638861) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is benzyl (3S,4R,5R)-3,4-dihydroxy-5-methoxypiperidine-1-carboxylate.
| Compound Name | benzyl (3S,4R,5R)-3,4-dihydroxy-5-methoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 42638861 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | benzyl (3S,4R,5R)-3,4-dihydroxy-5-methoxypiperidine-1-carboxylate |
| SMILES | CO[C@@H]1CN(C(=O)OCc2ccccc2)C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H19NO5/c1-19-12-8-15(7-11(16)13(12)17)14(18)20-9-10-5-3-2-4-6-10/h2-6,11-13,16-17H,7-9H2,1H3/t11-,12+,13+/m0/s1 |
| InChIKey | SJUGJTCFMQPOKM-YNEHKIRRSA-N |
| XLogP | 0.38 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |