C13H15NO4 — CID 87886908
benzyl (1R,5S,6S)-5-hydroxy-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 87886908) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is benzyl (1R,5S,6S)-5-hydroxy-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | benzyl (1R,5S,6S)-5-hydroxy-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 87886908 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | benzyl (1R,5S,6S)-5-hydroxy-7-oxa-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@H](O)[C@@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C13H15NO4/c15-10-6-14(7-11-12(10)18-11)13(16)17-8-9-4-2-1-3-5-9/h1-5,10-12,15H,6-8H2/t10-,11+,12-/m0/s1 |
| InChIKey | VTBYLZGORBUYJQ-TUAOUCFPSA-N |
| XLogP | 0.77 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|