C13H13NO4 — CID 102264136
benzyl (1R,5R)-7-oxo-6-oxa-3-azabicyclo[3.2.0]heptane-3-carboxylate (PubChem CID 102264136) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is benzyl (1R,5R)-7-oxo-6-oxa-3-azabicyclo[3.2.0]heptane-3-carboxylate.
| Compound Name | benzyl (1R,5R)-7-oxo-6-oxa-3-azabicyclo[3.2.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 102264136 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | benzyl (1R,5R)-7-oxo-6-oxa-3-azabicyclo[3.2.0]heptane-3-carboxylate |
| SMILES | O=C1O[C@H]2CN(C(=O)OCc3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C13H13NO4/c15-12-10-6-14(7-11(10)18-12)13(16)17-8-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11+/m1/s1 |
| InChIKey | ZAJPPYOZYHZEFV-MNOVXSKESA-N |
| XLogP | 1.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|