C14H17I2NO3 — CID 99564646
benzyl (2R,6R)-2,6-bis(iodomethyl)morpholine-4-carboxylate (PubChem CID 99564646) has the molecular formula C14H17I2NO3 and a molecular weight of 501.10 g/mol. Its IUPAC name is benzyl (2R,6R)-2,6-bis(iodomethyl)morpholine-4-carboxylate.
| Compound Name | benzyl (2R,6R)-2,6-bis(iodomethyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 99564646 |
| Molecular Formula | C14H17I2NO3 |
| Molecular Weight | 501.10 g/mol |
| Exact Mass | 500.93 |
| IUPAC Name | benzyl (2R,6R)-2,6-bis(iodomethyl)morpholine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@H](CI)O[C@@H](CI)C1 |
| InChI | InChI=1S/C14H17I2NO3/c15-6-12-8-17(9-13(7-16)20-12)14(18)19-10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2/t12-,13-/m0/s1 |
| InChIKey | MYBQOGMLRAPBFM-STQMWFEESA-N |
| XLogP | 3.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.10 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|