C13H14INO4 — CID 89452994
(3R,4S)-4-iodo-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (PubChem CID 89452994) has the molecular formula C13H14INO4 and a molecular weight of 375.16 g/mol. Its IUPAC name is (3R,4S)-4-iodo-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4S)-4-iodo-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 89452994 |
| Molecular Formula | C13H14INO4 |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | (3R,4S)-4-iodo-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(C(=O)OCc2ccccc2)C[C@H]1I |
| InChI | InChI=1S/C13H14INO4/c14-11-7-15(6-10(11)12(16)17)13(18)19-8-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,16,17)/t10-,11+/m0/s1 |
| InChIKey | NJMGCLOYTJMQKP-WDEREUQCSA-N |
| XLogP | 2.14 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|