C14H18N4O2 — CID 59382935
benzyl (3R,4R)-4-azido-3-methylpiperidine-1-carboxylate (PubChem CID 59382935) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is benzyl (3R,4R)-4-azido-3-methylpiperidine-1-carboxylate.
| Compound Name | benzyl (3R,4R)-4-azido-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 59382935 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | benzyl (3R,4R)-4-azido-3-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OCc2ccccc2)CC[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H18N4O2/c1-11-9-18(8-7-13(11)16-17-15)14(19)20-10-12-5-3-2-4-6-12/h2-6,11,13H,7-10H2,1H3/t11-,13-/m1/s1 |
| InChIKey | JRYGQALRHBFMSR-DGCLKSJQSA-N |
| XLogP | 3.34 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|