C14H18N4O3 — CID 121288216
benzyl (3S,4S)-3-azido-4-hydroxyazepane-1-carboxylate (PubChem CID 121288216) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is benzyl (3S,4S)-3-azido-4-hydroxyazepane-1-carboxylate.
| Compound Name | benzyl (3S,4S)-3-azido-4-hydroxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 121288216 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | benzyl (3S,4S)-3-azido-4-hydroxyazepane-1-carboxylate |
| SMILES | [N-]=[N+]=N[C@H]1CN(C(=O)OCc2ccccc2)CCC[C@@H]1O |
| InChI | InChI=1S/C14H18N4O3/c15-17-16-12-9-18(8-4-7-13(12)19)14(20)21-10-11-5-2-1-3-6-11/h1-3,5-6,12-13,19H,4,7-10H2/t12-,13-/m0/s1 |
| InChIKey | CGTJGQFYDHQZGK-STQMWFEESA-N |
| XLogP | 2.46 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|