C12H14N4O5 — CID 58395781
benzyl (3R,4R)-3-azido-4-(trioxidanyl)pyrrolidine-1-carboxylate (PubChem CID 58395781) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is benzyl (3R,4R)-3-azido-4-(trioxidanyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R,4R)-3-azido-4-(trioxidanyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58395781 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | benzyl (3R,4R)-3-azido-4-(trioxidanyl)pyrrolidine-1-carboxylate |
| SMILES | [N-]=[N+]=N[C@@H]1CN(C(=O)OCc2ccccc2)C[C@H]1OOO |
| InChI | InChI=1S/C12H14N4O5/c13-15-14-10-6-16(7-11(10)20-21-18)12(17)19-8-9-4-2-1-3-5-9/h1-5,10-11,18H,6-8H2/t10-,11-/m1/s1 |
| InChIKey | XQTDAILOYXCDOY-GHMZBOCLSA-N |
| XLogP | 2.11 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|