C16H22N4O3 — CID 71242971
tert-butyl (3S,4S)-3-azido-4-phenylmethoxypyrrolidine-1-carboxylate (PubChem CID 71242971) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-azido-4-phenylmethoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-azido-4-phenylmethoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71242971 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | tert-butyl (3S,4S)-3-azido-4-phenylmethoxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N=[N+]=[N-])[C@@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H22N4O3/c1-16(2,3)23-15(21)20-9-13(18-19-17)14(10-20)22-11-12-7-5-4-6-8-12/h4-8,13-14H,9-11H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | WLOFXVIPKYWHJD-KBPBESRZSA-N |
| XLogP | 3.50 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|