C16H22N4O5S — CID 118041838
tert-butyl (3S,4R)-3-azido-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate (PubChem CID 118041838) has the molecular formula C16H22N4O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-azido-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-azido-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118041838 |
| Molecular Formula | C16H22N4O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | tert-butyl (3S,4R)-3-azido-4-(4-methylphenyl)sulfonyloxypyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CN(C(=O)OC(C)(C)C)C[C@@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C16H22N4O5S/c1-11-5-7-12(8-6-11)26(22,23)25-14-10-20(9-13(14)18-19-17)15(21)24-16(2,3)4/h5-8,13-14H,9-10H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | RUJIWKXHDKTHHI-UONOGXRCSA-N |
| XLogP | 3.00 |
| TPSA | 121.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|