C24H31NO8S2 — CID 125180404
tert-butyl (3R,4R)-3,4-bis-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate (PubChem CID 125180404) has the molecular formula C24H31NO8S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3,4-bis-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3,4-bis-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 125180404 |
| Molecular Formula | C24H31NO8S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | tert-butyl (3R,4R)-3,4-bis-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CCN(C(=O)OC(C)(C)C)C[C@H]2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H31NO8S2/c1-17-6-10-19(11-7-17)34(27,28)32-21-14-15-25(23(26)31-24(3,4)5)16-22(21)33-35(29,30)20-12-8-18(2)9-13-20/h6-13,21-22H,14-16H2,1-5H3/t21-,22-/m1/s1 |
| InChIKey | MRFOWLCZIWDGCA-FGZHOGPDSA-N |
| XLogP | 3.79 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|