C18H27NO5S — CID 129258854
tert-butyl (4R)-4-(4-methylphenyl)sulfonyloxyazepane-1-carboxylate (PubChem CID 129258854) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is tert-butyl (4R)-4-(4-methylphenyl)sulfonyloxyazepane-1-carboxylate.
| Compound Name | tert-butyl (4R)-4-(4-methylphenyl)sulfonyloxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 129258854 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | tert-butyl (4R)-4-(4-methylphenyl)sulfonyloxyazepane-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CCCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H27NO5S/c1-14-7-9-16(10-8-14)25(21,22)24-15-6-5-12-19(13-11-15)17(20)23-18(2,3)4/h7-10,15H,5-6,11-13H2,1-4H3/t15-/m1/s1 |
| InChIKey | PDYBFQJGNYALQV-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|