C16H22FNO5S — CID 129250649
tert-butyl 3-fluoro-3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate (PubChem CID 129250649) has the molecular formula C16H22FNO5S and a molecular weight of 359.42 g/mol. Its IUPAC name is tert-butyl 3-fluoro-3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 129250649 |
| Molecular Formula | C16H22FNO5S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | tert-butyl 3-fluoro-3-[(4-methylphenyl)sulfonyloxymethyl]azetidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2(F)CN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C16H22FNO5S/c1-12-5-7-13(8-6-12)24(20,21)22-11-16(17)9-18(10-16)14(19)23-15(2,3)4/h5-8H,9-11H2,1-4H3 |
| InChIKey | QHCKOPQPUKHMSX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|