C19H27F2NO5S — CID 123284066
tert-butyl 4,4-difluoro-2-[3-(4-methylphenyl)sulfonyloxypropyl]pyrrolidine-1-carboxylate (PubChem CID 123284066) has the molecular formula C19H27F2NO5S and a molecular weight of 419.49 g/mol. Its IUPAC name is tert-butyl 4,4-difluoro-2-[3-(4-methylphenyl)sulfonyloxypropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4,4-difluoro-2-[3-(4-methylphenyl)sulfonyloxypropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123284066 |
| Molecular Formula | C19H27F2NO5S |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | tert-butyl 4,4-difluoro-2-[3-(4-methylphenyl)sulfonyloxypropyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC2CC(F)(F)CN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H27F2NO5S/c1-14-7-9-16(10-8-14)28(24,25)26-11-5-6-15-12-19(20,21)13-22(15)17(23)27-18(2,3)4/h7-10,15H,5-6,11-13H2,1-4H3 |
| InChIKey | LMKRKHBFXUZGKE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|