C16H25F2NO4 — CID 140752905
tert-butyl (2S)-2-[(E)-5-ethoxy-5-oxopent-3-enyl]-4,4-difluoropyrrolidine-1-carboxylate (PubChem CID 140752905) has the molecular formula C16H25F2NO4 and a molecular weight of 333.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(E)-5-ethoxy-5-oxopent-3-enyl]-4,4-difluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(E)-5-ethoxy-5-oxopent-3-enyl]-4,4-difluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140752905 |
| Molecular Formula | C16H25F2NO4 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | tert-butyl (2S)-2-[(E)-5-ethoxy-5-oxopent-3-enyl]-4,4-difluoropyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)/C=C/CC[C@H]1CC(F)(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25F2NO4/c1-5-22-13(20)9-7-6-8-12-10-16(17,18)11-19(12)14(21)23-15(2,3)4/h7,9,12H,5-6,8,10-11H2,1-4H3/b9-7+/t12-/m0/s1 |
| InChIKey | LRYKBBNCFNMVQY-CRALRDPISA-N |
| XLogP | 3.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|