C15H25NO4 — CID 52916325
tert-butyl (2R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate (PubChem CID 52916325) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 52916325 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | tert-butyl (2R)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)/C=C/[C@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25NO4/c1-5-19-13(17)10-9-12-8-6-7-11-16(12)14(18)20-15(2,3)4/h9-10,12H,5-8,11H2,1-4H3/b10-9+/t12-/m1/s1 |
| InChIKey | LSVNHQKKSIBYCM-BZYZDCJZSA-N |
| XLogP | 2.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|