C11H20N2O4S — CID 175162311
tert-butyl 2-[(Z)-2-sulfamoylethenyl]pyrrolidine-1-carboxylate (PubChem CID 175162311) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is tert-butyl 2-[(Z)-2-sulfamoylethenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(Z)-2-sulfamoylethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175162311 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | tert-butyl 2-[(Z)-2-sulfamoylethenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1/C=C\S(N)(=O)=O |
| InChI | InChI=1S/C11H20N2O4S/c1-11(2,3)17-10(14)13-7-4-5-9(13)6-8-18(12,15)16/h6,8-9H,4-5,7H2,1-3H3,(H2,12,15,16)/b8-6- |
| InChIKey | NIASXSNPLHNDKA-VURMDHGXSA-N |
| XLogP | 1.19 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |