C7H12N2O4S — CID 154997321
2-(2-sulfamoylethenyl)pyrrolidine-1-carboxylic acid (PubChem CID 154997321) has the molecular formula C7H12N2O4S and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-(2-sulfamoylethenyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 2-(2-sulfamoylethenyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154997321 |
| Molecular Formula | C7H12N2O4S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-(2-sulfamoylethenyl)pyrrolidine-1-carboxylic acid |
| SMILES | NS(=O)(=O)C=CC1CCCN1C(=O)O |
| InChI | InChI=1S/C7H12N2O4S/c8-14(12,13)5-3-6-2-1-4-9(6)7(10)11/h3,5-6H,1-2,4H2,(H,10,11)(H2,8,12,13) |
| InChIKey | BIBABFSHIMFXCY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |