C13H18F5NO2 — CID 173379492
(2S)-2-(7,7,8,8,8-pentafluorooct-1-enyl)pyrrolidine-1-carboxylic acid (PubChem CID 173379492) has the molecular formula C13H18F5NO2 and a molecular weight of 315.28 g/mol. Its IUPAC name is (2S)-2-(7,7,8,8,8-pentafluorooct-1-enyl)pyrrolidine-1-carboxylic acid.
| Compound Name | (2S)-2-(7,7,8,8,8-pentafluorooct-1-enyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 173379492 |
| Molecular Formula | C13H18F5NO2 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2S)-2-(7,7,8,8,8-pentafluorooct-1-enyl)pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC[C@H]1C=CCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H18F5NO2/c14-12(15,13(16,17)18)8-4-2-1-3-6-10-7-5-9-19(10)11(20)21/h3,6,10H,1-2,4-5,7-9H2,(H,20,21)/t10-/m1/s1 |
| InChIKey | RWTCVLCKGXPWLI-SNVBAGLBSA-N |
| XLogP | 4.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|