C19H27NO2 — CID 102467264
benzyl 2-[(E)-hept-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 102467264) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is benzyl 2-[(E)-hept-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[(E)-hept-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102467264 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | benzyl 2-[(E)-hept-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCC/C=C/C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO2/c1-2-3-4-5-9-13-18-14-10-15-20(18)19(21)22-16-17-11-7-6-8-12-17/h6-9,11-13,18H,2-5,10,14-16H2,1H3/b13-9+ |
| InChIKey | VVIAJWWMHGFOLU-UKTHLTGXSA-N |
| XLogP | 4.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|