C19H27NO3 — CID 11012572
benzyl 2-(2-oxoheptyl)pyrrolidine-1-carboxylate (PubChem CID 11012572) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is benzyl 2-(2-oxoheptyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-(2-oxoheptyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11012572 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | benzyl 2-(2-oxoheptyl)pyrrolidine-1-carboxylate |
| SMILES | CCCCCC(=O)CC1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-2-3-5-12-18(21)14-17-11-8-13-20(17)19(22)23-15-16-9-6-4-7-10-16/h4,6-7,9-10,17H,2-3,5,8,11-15H2,1H3 |
| InChIKey | BLVDHDCTHKABAP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|