C22H31NO3 — CID 11002835
benzyl (2S)-2-[(E,2R)-5-oxodec-3-en-2-yl]pyrrolidine-1-carboxylate (PubChem CID 11002835) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is benzyl (2S)-2-[(E,2R)-5-oxodec-3-en-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[(E,2R)-5-oxodec-3-en-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11002835 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | benzyl (2S)-2-[(E,2R)-5-oxodec-3-en-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCC(=O)/C=C/[C@@H](C)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H31NO3/c1-3-4-6-12-20(24)15-14-18(2)21-13-9-16-23(21)22(25)26-17-19-10-7-5-8-11-19/h5,7-8,10-11,14-15,18,21H,3-4,6,9,12-13,16-17H2,1-2H3/b15-14+/t18-,21+/m1/s1 |
| InChIKey | UQYGXUPAUQMUHX-IRPQCHLDSA-N |
| XLogP | 5.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|