C22H31NO6 — CID 156633155
2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-(1-phenylmethoxycarbonylpyrrolidin-2-yl)butanoic acid (PubChem CID 156633155) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-(1-phenylmethoxycarbonylpyrrolidin-2-yl)butanoic acid.
| Compound Name | 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-(1-phenylmethoxycarbonylpyrrolidin-2-yl)butanoic acid |
|---|---|
| PubChem CID | 156633155 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-3-(1-phenylmethoxycarbonylpyrrolidin-2-yl)butanoic acid |
| SMILES | CC(C1CCCN1C(=O)OCc1ccccc1)C(C)(C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31NO6/c1-15(22(5,18(24)25)19(26)29-21(2,3)4)17-12-9-13-23(17)20(27)28-14-16-10-7-6-8-11-16/h6-8,10-11,15,17H,9,12-14H2,1-5H3,(H,24,25) |
| InChIKey | SFWUQAYMWOJDPL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|