C17H25NO2S2 — CID 101064056
benzyl (2R)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 101064056) has the molecular formula C17H25NO2S2 and a molecular weight of 339.53 g/mol. Its IUPAC name is benzyl (2R)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101064056 |
| Molecular Formula | C17H25NO2S2 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | benzyl (2R)-2-[bis(ethylsulfanyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CCSC(SCC)[C@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H25NO2S2/c1-3-21-16(22-4-2)15-11-8-12-18(15)17(19)20-13-14-9-6-5-7-10-14/h5-7,9-10,15-16H,3-4,8,11-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | OGOVTMRHDOPIEM-OAHLLOKOSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|